4-Amino-3-nitropyridine is a chemical compound used primarily as a pharmaceutical intermediate. It features a pyridine ring substituted with an amino group and a nitro group, and is employed in the synthesis of other chemical substances for research and manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1681-37-4
(S)-2-AMINO-1-(3-CHLORO-PHENYL)-ETHANOL
Pharmaceutical intermediate
(S)-DMT-glycidol-T
pharmaceutical intermediate for oligonucleotide synthesis
(S)-GNA-T-phosphoramidite
Pharmaceutical intermediate for GNA synthesis
1-[(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-5-methylpyrimidine-2,4-dione
pharmaceutical intermediate
3-nitropyridin-4-amine
IUPPEELMBOPLDJ-UHFFFAOYSA-N
C1=CN=CC(=C1N)[N+](=O)[O-]