This compound is a pharmaceutical intermediate characterized by a molecular structure containing aromatic rings, ether linkages, an alcohol group, and a heterocyclic pyrimidinedione core. Its primary significance lies in its use as a building block in the manufacturing of pharmaceutical products.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 168332-14-7
2'-O-(2-Methoxyethyl)adenosine
pharmaceutical intermediate
(3R)-1-benzylpiperidin-3-amine
pharmaceutical intermediate
(S)-3-Amino-1-benzylpiperidine
pharmaceutical intermediate
Tetrahydro-2-furancarboxylic acid
pharmaceutical intermediate
(S)-DMT-glycidol-T
pharmaceutical intermediate for oligonucleotide synthesis
(S)-GNA-T-phosphoramidite
Pharmaceutical intermediate for GNA synthesis
(S)-GNA-U-phosphoramidite
Phosphoramidite building block for oligonucleotide synthesis
1-[(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-5-methylpyrimidine-2,4-dione
IUULEBAFSFROKM-XMMPIXPASA-N
CC1=CN(C(=O)NC1=O)C[C@H](COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)O