(1S)-1-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-methoxyethanamine hydrochloride is a fluorinated aromatic amine compound used primarily as a laboratory research chemical. Its structure features an amine group, aromatic ring, ether linkages, and multiple halogen atoms, contributing to its moderate lipophilicity and polar surface area.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1646543-17-0
Magnesium, bromo-1-propynyl-
Grignard reagent for organic synthesis
Dimethyl 1-(2,2-dimethoxyethyl)-3-methoxy-4-oxo-1,4-dihydropyridine-2,5-dicarboxylate
Research compound
1,3-DIMETHOXY-D6-BENZENE
deuterated research standard
1-(4-fluorophenyl)piperidin-4-amine
pharmaceutical intermediate
(1S)-1-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-methoxyethanamine;hydrochloride
XWNDALYBMBNWNU-DDWIOCJRSA-N
COC[C@H](C1=CC(=C(C=C1)OC(F)(F)F)F)N.Cl
—