1,3-Dimethoxy-d6-benzene is a deuterated research standard, specifically the hexadeuterated form of 1,3-dimethoxybenzene where the methoxy groups contain trideuteriomethyl groups. It is commonly used as an internal standard or labeled compound in analytical chemistry and metabolic studies due to its stable isotope labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 1,3-DIMETHOXY-D6-BENZENE؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
1-(4-fluorophenyl)piperidin-4-amine
pharmaceutical intermediate
5-BROMO-4-CYCLOPROPYL-6-METHOXYPYRIMIDINE
research compound
2-Methoxynicotinic acid
research compound
7-Fluoroquinazolin-4(3H)-one
research compound
1,3-Dimethoxybenzene
Flavoring agent
1,3-bis(trideuteriomethoxy)benzene
DPZNOMCNRMUKPS-WFGJKAKNSA-N
[2H]C([2H])([2H])OC1=CC(=CC=C1)OC([2H])([2H])[2H]
هل تبحث عن شراء 1,3-DIMETHOXY-D6-BENZENE؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.