This compound is a protected amino acid derivative used in peptide synthesis. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group on the amino terminus and a tert-butoxycarbonyl (Boc) group on the indole nitrogen, enabling selective deprotection during solid-phase peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 163619-04-3
Fmoc-Trp(N-CH2-COOtBu)-OH
research compound
Boc-Trp(Boc)-OH
Protected amino acid building block
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(1-methyl-1H-indol-3-yl)propanoic acid
Building block for peptide synthesis
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-((2-(methylthio)ethyl)amino)-2-((3,3,3-trifluoropropyl)thio)-9H-purin-9-yl)tetrahydrofuran-3,4-diol
Pharmaceutical intermediate
Tributylamine (dichloromethylene)bis(phosphonate)
pharmaceutical intermediate
Afatinib Impurity I
pharmaceutical reference standard
2'-Deoxyadenosine monohydrate
pharmaceutical intermediate
Fmoc-L-Trp(Boc)-OH
protected amino acid building block
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid
ADOHASQZJSJZBT-AREMUKBSSA-N
CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35