Fmoc-L-Trp(Boc)-OH is a protected amino acid derivative used as a building block in peptide synthesis. It features fluorenylmethoxycarbonyl (Fmoc) protection on the amino group and tert-butoxycarbonyl (Boc) protection on the indole nitrogen of tryptophan.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 143824-78-6
Fmoc-Trp(N-CH2-COOtBu)-OH
research compound
Boc-Trp(Boc)-OH
Protected amino acid building block
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(1-methyl-1H-indol-3-yl)propanoic acid
Building block for peptide synthesis
(2S)-5-{[(benzyloxy)carbonyl]amino}-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid
protected amino acid building block
Cbz-L-Isoleucine dicyclohexylamine salt
protected amino acid building block
(R)-3-(((Benzyloxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)propanoic acid
protected amino acid building block
Boc-3-(3-pyridyl)-Ala-OH
protected amino acid building block
Endo-8-Azabicyclo[3.2.1]octan-3-ol hydrochloride
pharmaceutical intermediate
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid
ADOHASQZJSJZBT-SANMLTNESA-N
CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35