This compound is a chemical compound used as an intermediate in pharmaceutical manufacturing. Its structure features an aromatic ring, an alcohol group, and a halogen, contributing to its utility in stereoselective synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 162536-40-5
Boc-(2RS,3S)-AHPA
Pharmaceutical intermediate for peptide synthesis
3-tert-Butoxycarbonylamino-2-hydroxy-4-phenylbutyric acid
Boc-protected amino acid intermediate
N-Boc-(2S,3S)-3-amino-2-hydroxy-4-phenyl-butyric acid
Boc-protected amino acid intermediate
N-(methoxycarbonyl)-l-tert-leucine
peptide synthesis intermediate
N2'-Deacetyl-N2'-[4-[[4-[(2,5-dioxo-1-pyrrolidinyl)oxy]-4-oxobutyl]dithio]-4-methyl-1-oxopentyl]maytansine
antibody-drug conjugate linker payload
Tert-butyl 2-((1H-pyrrolo[2,3-b]pyridin-5-yl)oxy)-4-bromobenzoate
pharmaceutical intermediate
1-((4'-Chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-yl)methyl)piperazine dihydrochloride
pharmaceutical intermediate
1,1-Dimethylethyl N-((1S,2S)-3-chloro-2-hydroxy-1-(phenylmethyl)propyl)carbamate
pharmaceutical intermediate for synthesis
tert-butyl N-[(2S,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl]carbamate
GFGQSTIUFXHAJS-STQMWFEESA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@H](CCl)O