This compound is a Boc-protected amino acid intermediate, specifically a derivative of beta-alanine with hydroxy and benzyl substituents. It is used in pharmaceutical manufacturing as a building block for peptide synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 116661-86-0
1,1-Dimethylethyl N-((1S,2R)-3-chloro-2-hydroxy-1-(phenylmethyl)propyl)carbamate
Pharmaceutical intermediate
1,1-Dimethylethyl N-((1S,2S)-3-chloro-2-hydroxy-1-(phenylmethyl)propyl)carbamate
pharmaceutical intermediate for synthesis
N-(tert-Butoxycarbonyl)-L-phenylalanine
Boc-protected amino acid intermediate
3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoic acid
Boc-protected amino acid intermediate
N-boc-2-(indole-3-yl)-dl-glycine
Boc-protected amino acid intermediate
(S)-2-((tert-Butoxycarbonyl)amino)-2-(2-methoxyphenyl)acetic acid
Boc-protected amino acid intermediate
Methyl (3E)-2,3-dihydro-3-(methoxyphenylmethylene)-2-oxo-1H-indole-6-carboxylate
pharmaceutical intermediate
Rac Duloxetine 3-Thiophene IsoMer Oxalate
pharmaceutical intermediate impurity standard
(2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid
BHTRKISIDQZUQX-RYUDHWBXSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@@H](C(=O)O)O