HEPBS is a zwitterionic organic buffering agent belonging to the family of Good's buffers. It has a pKa within the physiological range, making it suitable for use in cell culture and other biological research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 161308-36-7
Hepps
buffer reagent
HEPES
zwitterionic biological buffer
Pyridine-3-sulfonyl chloride
research reagent
1-Methyl-1H-indole-2-carboxylic acid
Research compound
Ethyl Diphenylphosphonoacetate
research compound
4,4,5,5-TETRAMETHYL-2-[(1E)-PENT-1-EN-1-YL]-1,3,2-DIOXABOROLANE
Boronic ester synthetic reagent
4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid
LOJNFONOHINEFI-UHFFFAOYSA-N
C1CN(CCN1CCCCS(=O)(=O)O)CCO