This compound is a salt-form pharmaceutical intermediate used in the production of bromhexine derivatives. It features a complex polycyclic structure containing amine, alcohol, and halogen functional groups.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 15942-08-2
Ambroxol EP Impurity B
Pharmaceutical intermediate for ambroxol
(2s)-1-[(tert-butoxy)carbonyl]piperazine-2-carboxylic acid
Boc-protected piperazine carboxylic acid intermediate
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(2S)-6-azido-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid building block
(1R,2S)-1-(((1,1-Dimethylethoxy)carbonyl)amino)-2-ethenylcyclopropanecarboxylic acid
Pharmaceutical intermediate
Ambroxol Cyclic Impurity-d5 Dihydrochloride
n.a
4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol;hydrochloride
ICLHRFYBPXBCPE-UHFFFAOYSA-N
C1CC(CCC1N2CC3=C(C(=CC(=C3)Br)Br)NC2)O.Cl