This compound is a cyclopropane-based pharmaceutical intermediate featuring a protected amino acid structure. Its significance lies in its use as a building block for the synthesis of more complex pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 159622-10-3
Pyronaridine Impurity 13
Impurity reference standard for pyronaridine
1-boc-4-methylenepiperidine
Pharmaceutical intermediate
1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
Fmoc-Aad(otBu)-OH
Protected amino acid for peptide synthesis
trans-(1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid
RFAQWADNTLIWMG-RDDDGLTNSA-N
CC(C)(C)OC(=O)N[C@@]1(C[C@H]1C=C)C(=O)O
—