This compound is a pharmaceutical intermediate specifically used in the synthesis of eribulin, a complex macrocyclic ether known for its anticancer activity. It features a tetrahydrofuran ring with an attached iodinated alkene side chain and a pivalate ester group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 157322-47-9
Eribulin mesylate intermediate
Eribulin mesylate synthetic intermediate
1-BOC-3-[(DIMETHYLAMINO)METHYLENE]-4-OXOPIPERIDINE
Pharmaceutical intermediate
2'-dG(iBu)-2'-phosphoramidite
Phosphoramidite reagent for oligonucleotide synthesis
5-Chlorovaleryl chloride
Pharmaceutical intermediate
3-((2S,5S)-5-(3-hydroxypropyl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
3-((2S,5S)-5-((3R,5R)-5-Methyl-3-((methylsulfonyl)oxy)-6-(((trifluoromethyl)sulfonyl)oxy)hept-6-en-1-yl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
3-[5-(3-hydroxy-6-iodo-5-methylhept-6-enyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate
BATPHVGPKRJKIK-UHFFFAOYSA-N
CC(CC(CCC1C(=C)CC(O1)CCCOC(=O)C(C)(C)C)O)C(=C)I