9-Bromoanthracene is a brominated aromatic compound used as a research reagent in organic synthesis. Its structure consists of an anthracene core with a bromine substituent, making it a useful building block for constructing more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1564-64-3
3-Pyridinecarboxylic acid, 6-formyl-1,2-dihydro-2-oxo-
research compound
(4-Butoxy-2,3-difluorophenyl)boronic acid
Research intermediate for organic synthesis
Diethyl 2,6-pyridinedicarboxylate
research compound for crystallography
Pheophorbide a
research compound
9-bromoanthracene-d9
deuterated research reference standard
9,10-Dibromoanthracene
chemical reagent for synthesis
(2H10)Anthracene
deuterated internal standard
2,6-Dibromoanthracene
Research reagent for organic synthesis
9-bromoanthracene
ZIRVQSRSPDUEOJ-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C3C=CC=CC3=C2Br