This compound is a research compound featuring a pyridine ring with aldehyde and carboxylic acid functional groups. It is typically used as a laboratory reagent for chemical synthesis and structural studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 156459-21-1
(4-Butoxy-2,3-difluorophenyl)boronic acid
Research intermediate for organic synthesis
Diethyl 2,6-pyridinedicarboxylate
research compound for crystallography
Pheophorbide a
research compound
6-Methoxy-2-naphthaleneboronic acid
research compound
6-formyl-2-oxo-1H-pyridine-3-carboxylic acid
ZGGVRXHIAUODSC-UHFFFAOYSA-N
C1=C(NC(=O)C(=C1)C(=O)O)C=O
—