4-(Chlorosulfonyl)phenyl 2,2-dimethylpropanoate is a research compound featuring an aromatic ring, an ester group, and a sulfonyl chloride moiety. Its structure includes a chlorine atom and a branched ester substituent, contributing to its polarity and moderate lipophilicity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 150374-99-5
2-Fluoro-6-methoxybenzylamine
research compound
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol
deuterated NMR standard
(2Z)-[(4S)-4-Phenyl-4,5-dihydro-1,3-oxazol-2-yl][(4S)-4-phenyl-1,3-oxazolidin-2-ylidene]acetonitrile
research compound
1,1,2,2,3,4,5,6,7,8-decadeuterioacenaphthylene
Deuterated analytical reference standard
(4-chlorosulfonylphenyl) 2,2-dimethylpropanoate
BSRSTUAZWZWGRT-UHFFFAOYSA-N
CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)Cl