4-Acetylphenylboronic acid is a boronic acid derivative featuring an acetyl-substituted aromatic ring. It is commonly used as a research reagent in organic synthesis, particularly in cross-coupling reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 149104-90-5
3-Acetylphenylboronic acid
Boronic acid research reagent
B-Hexylboronic acid
Boronic acid research reagent
2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
4-Fluorophenylboronic acid
Boronic acid research reagent
(R)-5-Bromo-N-(4-(chlorodifluoromethoxy)phenyl)-6-(3-hydroxypyrrolidin-1-yl)nicotinamide
research compound
6-Nitropyridin-3-amine
Research reagent for hachimoji DNA
Trifluoromethanesulfonic acid
catalyst and acid titrant
Arachidonyltrifluoromethane
Phospholipase A2 inhibitor
(4-acetylphenyl)boronic acid
OBQRODBYVNIZJU-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C(=O)C)(O)O