Arachidonyltrifluoromethane (AACOCF3) is a fatty acid derivative and an analog of arachidonic acid. It is primarily used as a research compound that inhibits phospholipase A2, an enzyme involved in lipid metabolism.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 149301-79-1
1-(4-Nitrophenethyl)-3-propylurea
urea derivative for research
Sodium 3-((3-(((2,4-dimethylphenyl)amino)carbonyl)-2-hydroxy-1-naphthyl)azo)-4-hydroxybenzenesulphonate
Colorimetric reagent for magnesium determination
Bis(1,1,1,5,5,5-hexafluoropentane-2,4-dionato-O,O')nickel
research reagent for synthesis
(3-propoxyphenyl)boronic Acid
research compound for organic synthesis
(6Z,9Z,12Z,15Z)-1,1,1-trifluorohenicosa-6,9,12,15-tetraen-2-one
PLWROONZUDKYKG-DOFZRALJSA-N
CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)C(F)(F)F