This compound is a this compound, a research reagent with an indole core structure. It is primarily used as a building block or intermediate in laboratory research and chemical development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1481631-51-9
Factor B-IN-1
complement factor B inhibitor
(S)-(+)-2,3-Diaminopropionic Acid Hydrochloride
Non-protein amino acid research reagent
3-((Aminoiminomethyl)amino)-L-alanine monohydrochloride
Research reagent biochemical reference standard
Thiol-Modifier C6 S-S
Oligonucleotide synthesis linker reagent
tert-butyl 4-formyl-5-methoxy-7-methylindole-1-carboxylate
GCQVVLKDJOMDOY-UHFFFAOYSA-N
CC1=CC(=C(C2=C1N(C=C2)C(=O)OC(C)(C)C)C=O)OC