Factor B-IN-1 is a research reagent that functions as a complement factor B inhibitor. It is a small-molecule compound investigated for its role in modulating the complement system, specifically the alternative pathway.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1481631-75-7
(S)-(+)-2,3-Diaminopropionic Acid Hydrochloride
Non-protein amino acid research reagent
3-((Aminoiminomethyl)amino)-L-alanine monohydrochloride
Research reagent biochemical reference standard
Thiol-Modifier C6 S-S
Oligonucleotide synthesis linker reagent
Diphenyliodonium chloride
research reagent
2-[hydroxy-(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3H-benzimidazole-5-carbonitrile
IAUVRHDNBNIFFB-UHFFFAOYSA-N
CC1=CC(=C(C2=C1NC=C2)C(C3=NC4=C(N3)C=C(C=C4)C#N)O)OC