4-Chloro-D-phenylalanine hydrochloride is a research compound that serves as a salt form of a halogenated phenylalanine derivative. It is primarily used in laboratory settings as a reagent for studying biochemical pathways and amino acid analogs.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 147065-05-2
Alcaftadine Alcohol
pharmaceutical impurity reference standard
(4-chloronaphthalen-1-yl)boronic acid
research compound
N-((S)-1-(((S)-1-(Benzo[d]thiazol-2-yl)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)-4-methoxy-1H-indole-2-carboxamide
SARS-CoV 3CL protease inhibitor
2-Amino-3-(thiazol-4-yl)propanoic acid
research compound
(2R)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride
PFOCEDBJFKVRHU-DDWIOCJRSA-N
C1=CC(=CC=C1C[C@H](C(=O)O)N)Cl.Cl