This compound is a research reagent characterized as an inhibitor of the SARS-CoV 3CL protease. Its structure features multiple amide groups, aromatic rings, and a heterocyclic system, reflecting its intended application in antiviral compound studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1471484-62-4
2-Amino-3-(thiazol-4-yl)propanoic acid
research compound
N2-(4-(((2-Amino-4-oxo-4,8-dihydropteridin-6-yl)methyl)amino)benzoyl)-N5-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-L-glutamine
PEGylated folate probe for click chemistry
2-Chloro-4-(naphthalen-1-yl)-6-phenyl-1,3,5-triazine
Research chemical for organic synthesis
Ethyl 2-(1H-1,3-benzodiazol-2-yl)acetate
research compound
N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide
JBLLRCOZJMVOAE-HSQYWUDLSA-N
CC(C)C[C@@H](C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C2=NC3=CC=CC=C3S2)NC(=O)C4=CC5=C(N4)C=CC=C5OC