14-epi-triptolide is a stereoisomer of triptolide, a diterpenoid epoxide isolated from the traditional Chinese medicinal plant Tripterygium wilfordii. It is primarily used as a research compound to investigate the structure-activity relationships and biological properties of the triptolide scaffold.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 144539-79-7
6-(tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,5-a]pyridine
Research reagent for medicinal chemistry
(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-trityl-1H-imidazol-4-yl)propanamido)-2-methylpropanoic acid
Research compound for peptide synthesis
N-Succinimidyl palmitate
crosslinking reagent for bioconjugation
IvDde-L-Lys(Fmoc)-OH
protected amino acid derivative
Triptolide
phytogenic antineoplastic agent
(1S,2S,4S,5S,7R,8S,9S,11S,13S)-8-hydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one
DFBIRQPKNDILPW-FKXGARDLSA-N
CC(C)[C@@]12[C@@H](O1)[C@H]3[C@@]4(O3)[C@]5(CCC6=C([C@@H]5C[C@H]7[C@]4([C@H]2O)O7)COC6=O)C