This compound is a research reagent, specifically a protected amino acid derivative featuring a benzoic acid core with an N-methyl and tert-butoxycarbonyl (Boc) protecting group. Its significance lies in its use as a building block for peptide synthesis and other organic chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 141871-02-5
Methyl 1,4-dihydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
Methyl 1-chloro-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
2-Bromo-6-fluorotoluene
Research reagent for organic synthesis
Bis(benzonitrile)palladium chloride
coordination complex and catalyst precursor
2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid
UXLICAHPTWWCII-UHFFFAOYSA-N
CC(C)(C)OC(=O)N(C)C1=CC=CC=C1C(=O)O