Methyl 1,4-dihydroxy-7-phenoxyisoquinoline-3-carboxylate is a research compound with a molecular weight of 311. 08 and a logP of 2.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1421312-32-4
Methyl 1-chloro-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
2-Bromo-6-fluorotoluene
Research reagent for organic synthesis
Bis(benzonitrile)palladium chloride
coordination complex and catalyst precursor
Tetrakis(triphenylphosphine)palladium
catalyst for coupling reactions
methyl 4-hydroxy-1-oxo-7-phenoxy-2H-isoquinoline-3-carboxylate
WPFRVDGFFDXCKM-UHFFFAOYSA-N
COC(=O)C1=C(C2=C(C=C(C=C2)OC3=CC=CC=C3)C(=O)N1)O