Mal-PEG4-PFP ester is a heterobifunctional crosslinking reagent featuring a maleimide group and a pentafluorophenyl ester linked by a hydrophilic polyethylene glycol (PEG) spacer. It is primarily used in bioconjugation chemistry for the modification of biomolecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1415800-42-8
Mal-PEG2-PFP ester
heterobifunctional crosslinking reagent
T-Boc-N-amido-PEG12-acid
PEG-based linker for bioconjugation
4,6-DICHLORO-2-METHYLPYRIMIDINE-5-CARBALDEHYDE
research compound
Ethyl (2S,5R)-5-((benzyloxy)amino)piperidine-2-carboxylate
Research compound
(2-Butyl-5-nitrobenzofuran-3-yl)(4-methoxyphenyl)methanone
research compound
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate
XGSVXFAIAZKWST-UHFFFAOYSA-N
C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F