4-Carboxyphenylboronic acid is a boronic acid derivative containing both a carboxylic acid and a boronic acid functional group on an aromatic ring. It is primarily used as a synthetic building block in organic chemistry, particularly for cross-coupling reactions and the construction of more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 14047-29-1
Ethyl (4-chlorophenyl)acetate
research chemical
Selectfluor
electrophilic fluorinating agent
3-O-tert-Butyldimethylsilyl Calcifediol
Research compound for vitamin D metabolites
(R)-6-((1R,3aS,7aR,E)-4-((Z)-2-((3S,5R)-3,5-bis(tert-butyldimethylsilyloxy)-2-methylenecyclohexylidene)ethylidene)-7a-methyloctahydro-1H-inden-1-yl)-2-methylheptan-2-ol
Research reagent
4-boronobenzoic acid
SIAVMDKGVRXFAX-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C(=O)O)(O)O