3-O-tert-Butyldimethylsilyl Calcifediol is a synthetic derivative of calcifediol, a major vitamin D metabolite, modified with a tert-butyldimethylsilyl protecting group at the 3-position. It is primarily used as a research reagent for studying vitamin D metabolism and analytical chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 140710-90-3
Silane, (1,1-dimethylethyl)dimethyl[[(3beta,5E,7E)-9,10-secocholesta-5,7,10(19)-trien-3-yl]oxy]-
Vitamin D intermediate synthesis
(R)-6-((1R,3aS,7aR,E)-4-((Z)-2-((3S,5R)-3,5-bis(tert-butyldimethylsilyloxy)-2-methylenecyclohexylidene)ethylidene)-7a-methyloctahydro-1H-inden-1-yl)-2-methylheptan-2-ol
Research reagent
Calcifediol
active pharmaceutical ingredient
Calcifediol (monohydrate)
Active pharmaceutical ingredient
Dichloronickel;pyridine
research compound
Cis-4-(1,2,3,4-Tetrahydro-6-methoxy-2-phenyl-1-naphthalenyl)phenol
research compound
Magnesium, bromo-1-propenyl-
Grignard reagent for organic synthesis
Benzo-18-crown 6-Ether
crown ether for metal ion complexation
(6R)-6-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol
CTZMHDJIUFEYKE-NXMZLKDESA-N
C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O[Si](C)(C)C(C)(C)C)C