This compound is a hydrochloride salt of Fmoc-protected L-lysine, commonly used as a building block in solid-phase peptide synthesis. Its significance lies in the Fmoc (9-fluorenylmethoxycarbonyl) group, which temporarily protects the amino group during peptide chain assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 139262-23-0
Fmoc-L-lysine
Protected amino acid for peptide synthesis
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
Aceclofenac Methyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Aceclofenac Ethyl Ester
Pharmaceutical intermediate for aceclofenac production
Aceclofenac Tert-Butyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Tert-butyl 4-(methoxy(methyl)carbamoyl)piperidine-1-carboxylate
Pharmaceutical intermediate
Fmoc-D-Lys-OH.HCl
Fmoc-protected amino acid intermediate
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride
MVMZFAIUUXYFGY-FYZYNONXSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN)C(=O)O.Cl