Aceclofenac Tert-Butyl Ester is a chemical compound used as a pharmaceutical intermediate in the synthesis of the nonsteroidal anti-inflammatory drug aceclofenac. It features a tert-butyl ester protecting group and contains aromatic rings and halogen substituents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 139272-68-7
Aceclofenac Methyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Tert-butyl 4-(methoxy(methyl)carbamoyl)piperidine-1-carboxylate
Pharmaceutical intermediate
(S)-3-(1-(dimethylamino)ethyl)phenol
pharmaceutical intermediate
1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azapentadecan-15-oic acid
Pharmaceutical intermediate for PEGylated compounds
5-Bromo-2-(trifluoromethoxy)benzyl chloride
Pharmaceutical intermediate
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate
QIQFYYWKRUYDTH-UHFFFAOYSA-N
CC(C)(C)OC(=O)COC(=O)CC1=CC=CC=C1NC2=C(C=CC=C2Cl)Cl