This compound is a protected derivative of D-threonine, featuring a fluorenylmethoxycarbonyl (Fmoc) group and a tert-butyl ether protecting group. It is commonly used as a building block in solid-phase peptide synthesis, enabling the incorporation of D-threonine residues with protected side chains.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 138797-71-4
(2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methoxybutanoic acid
Peptide building block
(2R)-2-{[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}-4-METHYLPENTANOIC ACID
Peptide synthesis building block
9-fluorenylmethyloxycarbonyl-D-Ser(t-butyl)-OH
Peptide synthesis building block
(2R,3R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Peptide synthesis building block
Fmoc-Cys(pMeOBzl)-OH
Peptide synthesis building block
2-cyclopropyl-2-oxoacetic acid
Pharmaceutical intermediate
O,N-didesmethyltramadol
tramadol metabolite
(Z)-3-(3-(3,5-bis(trifluoromethyl)phenyl)-1H-1,2,4-triazol-1-yl)acrylic acid
pharmaceutical intermediate for drug synthesis
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid
LZOLWEQBVPVDPR-VBKZILBWSA-N
C[C@@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C