This compound is an Fmoc-protected, N-methylated amino acid derivative used as a building block in solid-phase peptide synthesis. It features a fluorenylmethoxycarbonyl (Fmoc) group for temporary protection of the amine during peptide chain assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 138775-22-1
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-3-methylbutanoic acid
amino acid protecting reagent
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-4-methylpentanoic acid
Fmoc-protected amino acid for peptide synthesis
Fmoc-N-(2,4-dimethoxybenzyl)-Gly-OH
Fmoc-protected amino acid for peptide synthesis
Fmoc-L-Propargylglycine
Fmoc-protected amino acid for peptide synthesis
3-((Acetamidomethyl)sulfanyl)-N-(((9H-fluoren-9-yl)methoxy)carbonyl)-L-valine
Fmoc-protected amino acid for peptide synthesis
Methyl 4-nitro-1H-pyrazole-5-carboxylate
pharmaceutical intermediate
(2R,3S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
Peptide synthesis building block
2-cyclopropyl-2-oxoacetic acid
Pharmaceutical intermediate
(2S,3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid
IQIOLCJHRZWOLS-XOBRGWDASA-N
CC[C@H](C)[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13