This compound is a protected amino acid derivative used as a research reagent in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino function and an aminomethyl substituent on the aromatic ring, making it suitable for building modified peptide chains.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 137452-49-4
L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-
Protected amino acid for peptide synthesis
(2S)-2-{[(Tert-Butoxy)Carbonyl]Amino}-3-(4-Iodophenyl)Propanoic Acid
Protected amino acid for peptide synthesis
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid
protected amino acid for peptide synthesis
Boc-O-methyl-L-tyrosine
Protected amino acid intermediate
(2S)-2-amino-3-(tert-butoxy)propanoic acid
Research compound for peptide synthesis
O-Benzyl-D-serine
Research compound for peptide synthesis
(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-trityl-1H-imidazol-4-yl)propanamido)-2-methylpropanoic acid
Research compound for peptide synthesis
Fmoc-N-methyl-L-alloisoleucine
Research compound for peptide synthesis
(2S)-3-[4-(aminomethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
SRHQPVLBHXDZGC-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)CN)C(=O)O