Dipropyl pyridine-2,5-dicarboxylate is an agrochemical compound used primarily as an insect repellent. Its structure features a pyridine ring with two ester functional groups, contributing to its chemical properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 136-45-8
Dimethyl carbate
insect repellent
Urea, N-[2,6-bis(1-methylethyl)-4-phenoxyphenyl]-N'-(1,1-dimethylethyl)-
urea herbicide intermediate
3,5-dichloro-2,4,6-trifluorobenzoic acid
agrochemical intermediate
Thiram
Crop fungicide and seed protectant
ZIRAM
fungicide for vegetable diseases
dipropyl pyridine-2,5-dicarboxylate
IITCWRFYJWUUPC-UHFFFAOYSA-N
CCCOC(=O)C1=CN=C(C=C1)C(=O)OCCC