Mefenpyr-diethyl is a herbicide safener used to protect crops from the phytotoxic effects of certain herbicides. It is a pyrazole derivative containing ester functional groups and a dichlorophenyl ring, with a molecular weight of approximately 372 g/mol and moderate lipophilicity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 135590-91-9
diethyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate
OPGCOAPTHCZZIW-UHFFFAOYSA-N
CCOC(=O)C1=NN(C(C1)(C)C(=O)OCC)C2=C(C=C(C=C2)Cl)Cl