Ald-PEG4-NHS ester is a heterobifunctional crosslinking reagent used for bioconjugation. Its structure features an aldehyde group and an N-hydroxysuccinimide (NHS) ester linked by a hydrophilic polyethylene glycol (PEG) spacer, enabling site-specific conjugation of biomolecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1353011-74-1
Azido-PEG2-PFP ester
bioconjugation crosslinking reagent
Perfluorophenyl 3-(pyridin-2-yldisulfanyl)propanoate
bioconjugation crosslinking reagent
Azido-PEG8-NHS ester
bioconjugation crosslinking reagent
Azido-PEG4-PFP ester
bioconjugation and PEGylation reagent
11,12-Didehydro-gamma-oxodibenz[b,f]azocine-5(6H)-butanoic acid
click chemistry reagent
Dbco-nhs ester
Copper-free click chemistry reagent
2-Bromo-3-fluoro-5-nitropyridine
Research compound for organic synthesis
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate
QUFDNMPGNAZKHD-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)C2=CC=C(C=C2)C=O