Azido-PEG4-PFP ester is a research reagent featuring an azide group and a pentafluorophenyl ester moiety connected by a polyethylene glycol (PEG) spacer. It is primarily used in bioconjugation and PEGylation applications for laboratory research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1353012-00-6
Azido-PEG2-PFP ester
bioconjugation crosslinking reagent
11,12-Didehydro-gamma-oxodibenz[b,f]azocine-5(6H)-butanoic acid
click chemistry reagent
Dbco-nhs ester
Copper-free click chemistry reagent
2-Bromo-3-fluoro-5-nitropyridine
Research compound for organic synthesis
3,5-Diiodo-4-methylpyridin-2-amine
Research compound
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate
QSIFGTAWLLFXPY-UHFFFAOYSA-N
C(COCCOCCOCCOCCN=[N+]=[N-])C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F