3-O-Methyl Colterol-d9 is a deuterium-labeled research compound, structurally characterized as an aromatic amine with alcohol and ether functional groups. Its primary significance lies in its use as an isotopically labeled standard for analytical and laboratory research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1346599-83-4
N-(tert-Butoxycarbonyl)-L-alanine-1-13C
Isotopically labeled research compound
5-(4-HYDROXYPHENYL)-5-PHENYL-D5-HYDANTOIN-15N2
Isotopically labeled research compound
Methylamine-15N hydrochloride
Isotopically labeled research compound
9-beta-D-Ribofuranosyl-9H-purin-6-amine-15N
Isotopically labeled research compound
6-(Desmethyl)-7-methyl zolpidem
Reference standard for analytical testing
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
Rac N-Benzyl-N-desmethyl Tramadol-d3
deuterated analytical reference standard
(+/-)-N-Desmethyl Trifluoroacetotramadol-d3
research compound
4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]-2-methoxyphenol
WVGNWNYBARIPKQ-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C=C1)O)OC)O