This compound is a stable isotope-labeled derivative of a 1,3-diazolidine-2,4-dione structure, specifically deuterated and nitrogen-15 labeled on the heterocyclic ring. It is primarily used as a research reagent for analytical and investigational studies that require isotopic labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 369656-71-3
9-beta-D-Ribofuranosyl-9H-purin-6-amine-15N
Isotopically labeled research compound
Methylamine-15N hydrochloride
Isotopically labeled research compound
2-Naphthalen-1,3,4,5,6,7,8-d7-amine
Isotopically labeled research compound
Pyruvic acid-1-13C
Isotopically labeled research compound
1-(Ethoxycarbonyl)cyclopropanecarboxylic acid
Research compound
Triethyl 2-phosphonopropionate
phosphonate reagent for organic synthesis
(R)-2-AMINO-3-(BENZO[D][1,3]DIOXOL-5-YL)PROPANOIC ACID
research compound
5-CHLOROPYRIDINE-2-CARBOXAMIDE
research compound
5-(4-hydroxyphenyl)-5-(2,3,4,5,6-pentadeuteriophenyl)-(1,3-15N2)1,3-diazolidine-2,4-dione
XEEDURHPFVXALT-KUBOYCFXSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2(C(=O)[15NH]C(=O)[15NH]2)C3=CC=C(C=C3)O)[2H])[2H]
—