Ternidazole-d6 Hydrochloride is a deuterated research compound, specifically a hexadeuterated form of ternidazole where six hydrogen atoms are replaced with deuterium. It is supplied as a hydrochloride salt and is primarily used in research settings, often as a stable isotope-labeled internal standard or tracer.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1346599-62-9
Bis [2-[(2-Amino-1,6-dihydro-6-O-benzyl-9H-purin-9yl)methoxy]ethanol]
acyclovir impurity reference standard
3-O-Methyl Colterol-d9
Isotopically labeled research compound
6-(Desmethyl)-7-methyl zolpidem
Reference standard for analytical testing
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
2-Methyl-5-nitro-1H-imidazole-1-propanol monohydrochloride
Active pharmaceutical ingredient
Ternidazole
active pharmaceutical ingredient
1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol;hydrochloride
PTXLKVODAFRGDG-RYKMJATISA-N
[2H]C([2H])(C([2H])([2H])N1C(=NC=C1[N+](=O)[O-])C)C([2H])([2H])O.Cl