4-Bromochlorobenzene-d4 is a deuterated reference standard compound, specifically the tetradeuterated analogue of 1-bromo-4-chlorobenzene where all four aromatic hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard or labeled tracer in analytical chemistry, particularly for mass spectrometry and nuclear magnetic resonance spectroscopy.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 134415-42-2
(1R)-1-(3-chloro-4-fluorophenyl)ethan-1-ol
research compound
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
asymmetric hydrogenation catalyst
Gold triiodide
research compound
2,4-Diphenyl-6-(4,4,5,5-tetramethyl-[1,3,2] dioxaborolan-2-yl)-[1,3,5]triazine
research reagent
1-Bromo-4-chlorobenzene
Chemical intermediate for synthesis
1-bromo-4-chloro-2,3,5,6-tetradeuteriobenzene
NHDODQWIKUYWMW-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1Cl)[2H])[2H])Br)[2H]