This compound is a pharmaceutical intermediate used in the synthesis of ozanimod, a medication for autoimmune conditions. It features a nitrile group and a stereocenter, indicating its role in building complex molecular structures for drug development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1306763-31-4
3-((2-Chloromethyl-1-methyl-1H-benzimidazole-5-carbonyl)-pyridine-2-yl-amino)-propionic acid ethyl ester
Pharmaceutical intermediate for drug synthesis
2-Bromo-6-nitrophenol
pharmaceutical intermediate
Fmoc-D-Arg-OH
Peptide synthesis intermediate
3-oxo-8-aza-bicyclo[3.2.1]octane-8-carboxylic acid benzyl ester
pharmaceutical intermediate for tropane alkaloids
(S)-1-Amino-2,3-dihydro-1H-indene-4-carbonitrile hydrochloride
pharmaceutical intermediate for synthesis
(R)-1-Aminoindane-d3 Hydrochloride
deuterated pharmaceutical research standard
(1R,2S)-(+)-cis-1-Amino-2-indanol
Pharmaceutical intermediate for chiral synthesis
5-bromo-2,3-dihydro-1H-inden-4-amine
research compound
tert-butyl N-[(1S)-4-cyano-2,3-dihydro-1H-inden-1-yl]carbamate
LBHMMDUJKBJVQI-ZDUSSCGKSA-N
CC(C)(C)OC(=O)N[C@H]1CCC2=C(C=CC=C12)C#N