This compound is a pharmaceutical intermediate used in the synthesis of active pharmaceutical ingredients. It features a complex structure containing aromatic rings, an amide group, and a halogen atom, consistent with its role in drug manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1307233-94-8
2-Bromo-6-nitrophenol
pharmaceutical intermediate
Fmoc-D-Arg-OH
Peptide synthesis intermediate
3-oxo-8-aza-bicyclo[3.2.1]octane-8-carboxylic acid benzyl ester
pharmaceutical intermediate for tropane alkaloids
4,4'-(1,1'-Biphenyl-4,4'-diyldioxy)dianiline
Pharmaceutical intermediate
ethyl 3-[[2-(chloromethyl)-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate
ATDFBDBECQOWSX-UHFFFAOYSA-N
CCOC(=O)CCN(C1=CC=CC=N1)C(=O)C2=CC3=C(C=C2)N(C(=N3)CCl)C