Pyrene is a polycyclic aromatic hydrocarbon consisting of four fused benzene rings, forming a flat aromatic structure. It is the smallest peri-fused PAH and serves as an intermediate in the production of other chemical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 129-00-0
9,10-Benzophenanthrene
polycyclic aromatic hydrocarbon intermediate
Phenol, 4,4'-(3,3,5-trimethylcyclohexylidene)bis-
bisphenol monomer for polymer production
Bis(4-methacryloylthiophenyl) Sulfide
crosslinking monomer for polymers
(3R,6R)-3,6-Octanediol
Industrial chemical intermediate
(trans,trans)-4-(But-3-en-1-yl)-4'-(p-tolyl)-1,1'-bi(cyclohexane)
liquid crystal intermediate
Pyrene D10
deuterated internal standard for analysis
1-Aminopyrene
fluorescent probe for chemical research
1-Bromopyrene
research compound
pyrene
BBEAQIROQSPTKN-UHFFFAOYSA-N
C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2