This compound is a bisphenol derivative containing two phenolic hydroxyl groups and a substituted cyclohexane ring, used as a monomer in polymer production. Its structure features two aromatic rings and a relatively high lipophilicity, contributing to its role as a building block in specialty polymers.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 129188-99-4
Bis(4-methacryloylthiophenyl) Sulfide
crosslinking monomer for polymers
(3R,6R)-3,6-Octanediol
Industrial chemical intermediate
(trans,trans)-4-(But-3-en-1-yl)-4'-(p-tolyl)-1,1'-bi(cyclohexane)
liquid crystal intermediate
كربيد الألومنيوم
reducing agent and abrasive material
Phenol, 4,4'-cyclohexylidenebis[2-amino-
n.a
Bisphenol Z
n.a
4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol
UMPGNGRIGSEMTC-UHFFFAOYSA-N
CC1CC(CC(C1)(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)(C)C