This compound is a pentafluoro-λ6-sulfane-substituted phenylboronic ester used as a synthetic building block in chemical research. It features an aromatic ring with a boronate ester group and multiple fluorine atoms, contributing to its potential utility in cross-coupling reactions and molecular design.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1286278-34-9
(R)-N-(Piperidin-3-yl)acetamide
research compound
7,9-Dimesityl-7H-acenaphtho[1,2-d]imidazol-9-ium chloride
ligand for chemical synthesis
Bis(eta(5)-cyclopentadienyl)ruthenium;bis(eta(5)-cyclopentadienyl)ruthenium(II)
research compound
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate
Deuterated labelled research compound
pentafluoro-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-lambda6-sulfane
GSABJOBFIHVJIB-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(F)(F)(F)(F)F
—