This compound is a metallocene consisting of a ruthenium atom bound between two cyclopentadiene rings. It is identified as a research reagent and is commonly used in laboratory settings for synthetic and coordination chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1287-13-4
Dicyclopentadienyliron
antiknock gasoline additive
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate
Deuterated labelled research compound
(-)-Butorphanol-d6
pharmaceutical reference standard
4-(Trifluoromethyl)phenylboronic acid
research compound for organic synthesis
5H-Cyclohepta[b]pyridine, 5-azido-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-9-[[tris(1-methylethyl)silyl]oxy]-, (5S,6S,9R)-
research compound
Ethylferrocene
organoiron compound for chemical synthesis
BKEJVRMLCVMJLG-UHFFFAOYSA-N
C1=C[CH]C=C1.C1=C[CH]C=C1.[Ru]