This compound is a quaternary ammonium salt used as a structure-directing agent in chemical synthesis. It features a rigid adamantane core and is employed primarily in research and manufacturing applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 128346-46-3
N,N,N-Trimethyladamantan-1-aminium hydroxide
n.a
1-adamantyltrimethylammonium sulfate
Structure directing agent
(3,5-DIPHENYLPHENYL)BORONIC ACID
Boronic acid reagent for synthesis
Sodium;[hydroxy-[hydroxy-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate
research compound
1-(naphthalen-2-yl)-2-(piperidin-1-yl)ethane-1,2-dione
research compound
Fenoterol-d6 Hydrobromide
Isotopically labelled research compound
1-adamantyl(trimethyl)azanium chloride
FEAMTICPHLBOPE-UHFFFAOYSA-M
C[N+](C)(C)C12CC3CC(C1)CC(C3)C2.[Cl-]
—