(3,5-Diphenylphenyl)boronic acid is a boronic acid reagent used in chemical synthesis. It features three aromatic rings and is commonly employed as a building block in organic chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 128388-54-5
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
3-Tolylboronic acid
Boronic acid reagent for synthesis
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
Biphenyl-2-boronic acid
Boronic acid reagent for synthesis
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
Sodium;[hydroxy-[hydroxy-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate
research compound
1-(naphthalen-2-yl)-2-(piperidin-1-yl)ethane-1,2-dione
research compound
Fenoterol-d6 Hydrobromide
Isotopically labelled research compound
(3,5-diphenylphenyl)boronic acid
MRBZYVMZUBUDAX-UHFFFAOYSA-N
B(C1=CC(=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3)(O)O