Aminofluoro hydroxybenzoate is a research compound with a complex aromatic ester structure. It is characterized by the presence of amine, ether, and halogen functional groups, and is used primarily in laboratory research settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1253799-29-9
4-(naphthalen-1-yl)aniline
research compound
((Z)-2-((3R,4R,5R)-3,5-Bis((tert-butyldimethylsilyl)oxy)-4-(3-((tert-butyldiphenylsilyl)oxy)propoxy)-2-methylenecyclohexylidene)ethyl)diphenylphosphine oxide
chemical research reagent
4-Fluoro(phenyl-d4)-boronic acid
research compound
2-(4-Fluorophenyl)-7,8-dimethoxyquinolin-4(1H)-one
research compound
phenyl 5-(dibenzylamino)-3-fluoro-2-methyl-6-phenylmethoxybenzoate
VRXGVVAMXZXKNA-UHFFFAOYSA-N
CC1=C(C=C(C(=C1C(=O)OC2=CC=CC=C2)OCC3=CC=CC=C3)N(CC4=CC=CC=C4)CC5=CC=CC=C5)F