4-Fluoro(phenyl-d4)-boronic acid is a deuterated research compound containing a boronic acid functional group and a fluorine atom. Its primary significance lies in its use as a labeled reagent for analytical and synthetic chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1254771-90-8
2-(4-Fluorophenyl)-7,8-dimethoxyquinolin-4(1H)-one
research compound
4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-9H-CARBAZOLE
Borylation reagent for organic synthesis
2-Bromo-1,3-oxazole
Research reagent
Methyl-13C phenyl sulfone
isotopic labeled research compound
4-Fluorophenylboronic acid
Boronic acid research reagent
(2,3,5,6-tetradeuterio-4-fluorophenyl)boronic acid
LBUNNMJLXWQQBY-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1B(O)O)[2H])[2H])F)[2H]
—